C12H14N4O4S — CID 75508409
1-[3-(3-methylphenyl)sulfonylpropyl]-3-nitro-1,2,4-triazole (PubChem CID 75508409) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 1-[3-(3-methylphenyl)sulfonylpropyl]-3-nitro-1,2,4-triazole.
| Compound Name | 1-[3-(3-methylphenyl)sulfonylpropyl]-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 75508409 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-[3-(3-methylphenyl)sulfonylpropyl]-3-nitro-1,2,4-triazole |
| SMILES | Cc1cccc(S(=O)(=O)CCCn2cnc([N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C12H14N4O4S/c1-10-4-2-5-11(8-10)21(19,20)7-3-6-15-9-13-12(14-15)16(17)18/h2,4-5,8-9H,3,6-7H2,1H3 |
| InChIKey | LILWRTRPSCWMED-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 107.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|