C11H7N5O3 — CID 60709677
1-[2-(3-nitrophenyl)-2-oxoethyl]-1,2,4-triazole-3-carbonitrile (PubChem CID 60709677) has the molecular formula C11H7N5O3 and a molecular weight of 257.21 g/mol. Its IUPAC name is 1-[2-(3-nitrophenyl)-2-oxoethyl]-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-[2-(3-nitrophenyl)-2-oxoethyl]-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 60709677 |
| Molecular Formula | C11H7N5O3 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 1-[2-(3-nitrophenyl)-2-oxoethyl]-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(CC(=O)c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H7N5O3/c12-5-11-13-7-15(14-11)6-10(17)8-2-1-3-9(4-8)16(18)19/h1-4,7H,6H2 |
| InChIKey | DMYTXDJBIFRORG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 114.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|