C13H7N5O3 — CID 115944797
1-[2-(3-nitrophenyl)-2-oxoethyl]imidazole-4,5-dicarbonitrile (PubChem CID 115944797) has the molecular formula C13H7N5O3 and a molecular weight of 281.23 g/mol. Its IUPAC name is 1-[2-(3-nitrophenyl)-2-oxoethyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[2-(3-nitrophenyl)-2-oxoethyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 115944797 |
| Molecular Formula | C13H7N5O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 1-[2-(3-nitrophenyl)-2-oxoethyl]imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(CC(=O)c2cccc([N+](=O)[O-])c2)c1C#N |
| InChI | InChI=1S/C13H7N5O3/c14-5-11-12(6-15)17(8-16-11)7-13(19)9-2-1-3-10(4-9)18(20)21/h1-4,8H,7H2 |
| InChIKey | MJZGYIUKPWBLHC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 125.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|