C12H5N5O4 — CID 115944688
2-(4,5-dicyanoimidazol-1-yl)-4-nitrobenzoic acid (PubChem CID 115944688) has the molecular formula C12H5N5O4 and a molecular weight of 283.20 g/mol. Its IUPAC name is 2-(4,5-dicyanoimidazol-1-yl)-4-nitrobenzoic acid.
| Compound Name | 2-(4,5-dicyanoimidazol-1-yl)-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 115944688 |
| Molecular Formula | C12H5N5O4 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 2-(4,5-dicyanoimidazol-1-yl)-4-nitrobenzoic acid |
| SMILES | N#Cc1ncn(-c2cc([N+](=O)[O-])ccc2C(=O)O)c1C#N |
| InChI | InChI=1S/C12H5N5O4/c13-4-9-11(5-14)16(6-15-9)10-3-7(17(20)21)1-2-8(10)12(18)19/h1-3,6H,(H,18,19) |
| InChIKey | GOPORAOIHPJDSB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 145.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|