C12H5FN4O2 — CID 112595426
4-(4,5-dicyanoimidazol-1-yl)-3-fluorobenzoic acid (PubChem CID 112595426) has the molecular formula C12H5FN4O2 and a molecular weight of 256.20 g/mol. Its IUPAC name is 4-(4,5-dicyanoimidazol-1-yl)-3-fluorobenzoic acid.
| Compound Name | 4-(4,5-dicyanoimidazol-1-yl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 112595426 |
| Molecular Formula | C12H5FN4O2 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-(4,5-dicyanoimidazol-1-yl)-3-fluorobenzoic acid |
| SMILES | N#Cc1ncn(-c2ccc(C(=O)O)cc2F)c1C#N |
| InChI | InChI=1S/C12H5FN4O2/c13-8-3-7(12(18)19)1-2-10(8)17-6-16-9(4-14)11(17)5-15/h1-3,6H,(H,18,19) |
| InChIKey | OUYPQDLUTVMPFI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |