C13H8FN5O2 — CID 115944890
methyl 2-amino-5-(4,5-dicyanoimidazol-1-yl)-4-fluorobenzoate (PubChem CID 115944890) has the molecular formula C13H8FN5O2 and a molecular weight of 285.24 g/mol. Its IUPAC name is methyl 2-amino-5-(4,5-dicyanoimidazol-1-yl)-4-fluorobenzoate.
| Compound Name | methyl 2-amino-5-(4,5-dicyanoimidazol-1-yl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 115944890 |
| Molecular Formula | C13H8FN5O2 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | methyl 2-amino-5-(4,5-dicyanoimidazol-1-yl)-4-fluorobenzoate |
| SMILES | COC(=O)c1cc(-n2cnc(C#N)c2C#N)c(F)cc1N |
| InChI | InChI=1S/C13H8FN5O2/c1-21-13(20)7-2-11(8(14)3-9(7)17)19-6-18-10(4-15)12(19)5-16/h2-3,6H,17H2,1H3 |
| InChIKey | LBNFFHHJHTZELR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|