C12H6FN5O2 — CID 103594391
1-(4-fluoro-5-methyl-2-nitrophenyl)imidazole-4,5-dicarbonitrile (PubChem CID 103594391) has the molecular formula C12H6FN5O2 and a molecular weight of 271.21 g/mol. Its IUPAC name is 1-(4-fluoro-5-methyl-2-nitrophenyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(4-fluoro-5-methyl-2-nitrophenyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 103594391 |
| Molecular Formula | C12H6FN5O2 |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-(4-fluoro-5-methyl-2-nitrophenyl)imidazole-4,5-dicarbonitrile |
| SMILES | Cc1cc(-n2cnc(C#N)c2C#N)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H6FN5O2/c1-7-2-10(11(18(19)20)3-8(7)13)17-6-16-9(4-14)12(17)5-15/h2-3,6H,1H3 |
| InChIKey | WSIZSVFZVANGHB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 108.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|