C11H3ClFN5O2 — CID 115945020
1-(4-chloro-5-fluoro-2-nitrophenyl)imidazole-4,5-dicarbonitrile (PubChem CID 115945020) has the molecular formula C11H3ClFN5O2 and a molecular weight of 291.63 g/mol. Its IUPAC name is 1-(4-chloro-5-fluoro-2-nitrophenyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(4-chloro-5-fluoro-2-nitrophenyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 115945020 |
| Molecular Formula | C11H3ClFN5O2 |
| Molecular Weight | 291.63 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 1-(4-chloro-5-fluoro-2-nitrophenyl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(-c2cc(F)c(Cl)cc2[N+](=O)[O-])c1C#N |
| InChI | InChI=1S/C11H3ClFN5O2/c12-6-1-10(18(19)20)9(2-7(6)13)17-5-16-8(3-14)11(17)4-15/h1-2,5H |
| InChIKey | VUWBPMMCFOFRSK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.63 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|