C10H4ClN5 — CID 112595880
1-(3-chloro-4-pyridinyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595880) has the molecular formula C10H4ClN5 and a molecular weight of 229.63 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(3-chloro-4-pyridinyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595880 |
| Molecular Formula | C10H4ClN5 |
| Molecular Weight | 229.63 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(-c2ccncc2Cl)c1C#N |
| InChI | InChI=1S/C10H4ClN5/c11-7-5-14-2-1-9(7)16-6-15-8(3-12)10(16)4-13/h1-2,5-6H |
| InChIKey | OXJOZFIFUVJDIC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |