C14H8N6 — CID 106948556
1-(5-aminoisoquinolin-6-yl)imidazole-4,5-dicarbonitrile (PubChem CID 106948556) has the molecular formula C14H8N6 and a molecular weight of 260.26 g/mol. Its IUPAC name is 1-(5-aminoisoquinolin-6-yl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(5-aminoisoquinolin-6-yl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 106948556 |
| Molecular Formula | C14H8N6 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-(5-aminoisoquinolin-6-yl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(-c2ccc3cnccc3c2N)c1C#N |
| InChI | InChI=1S/C14H8N6/c15-5-11-13(6-16)20(8-19-11)12-2-1-9-7-18-4-3-10(9)14(12)17/h1-4,7-8H,17H2 |
| InChIKey | NOHASKGOCSQUET-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|