About 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine
6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine (PubChem CID 106948537) has the molecular formula C14H13ClN4
and a molecular weight of 272.74 g/mol. Its IUPAC name is 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine.
Molecular Properties
| Compound Name | 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine |
| PubChem CID | 106948537 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine |
| SMILES | Cc1nn(-c2ccc3cnccc3c2N)c(C)c1Cl |
| InChI | InChI=1S/C14H13ClN4/c1-8-13(15)9(2)19(18-8)12-4-3-10-7-17-6-5-11(10)14(12)16/h3-7H,16H2,1-2H3 |
| InChIKey | MQGGYJJTFGFKSY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine?
The IUPAC name of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine (CID 106948537) is 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine.
What is the SMILES notation for 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine?
The canonical SMILES for 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine is Cc1nn(-c2ccc3cnccc3c2N)c(C)c1Cl.
What is the InChIKey of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine?
The InChIKey is MQGGYJJTFGFKSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN4/c1-8-13(15)9(2)19(18-8)12-4-3-10-7-17-6-5-11(10)14(12)16/h3-7H,16H2,1-2H3.
What are the key properties of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine?
6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine has a molecular weight of 272.74 g/mol, XLogP of 3.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chloro-3,5-dimethylpyrazol-1-yl)isoquinolin-5-amine is sourced from PubChem (CID 106948537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).