C12H13Cl2N3 — CID 112740943
4-chloro-2-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-methylaniline (PubChem CID 112740943) has the molecular formula C12H13Cl2N3 and a molecular weight of 270.16 g/mol. Its IUPAC name is 4-chloro-2-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-methylaniline.
| Compound Name | 4-chloro-2-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-methylaniline |
|---|---|
| PubChem CID | 112740943 |
| Molecular Formula | C12H13Cl2N3 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 4-chloro-2-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-methylaniline |
| SMILES | Cc1nn(-c2c(N)ccc(Cl)c2C)c(C)c1Cl |
| InChI | InChI=1S/C12H13Cl2N3/c1-6-9(13)4-5-10(15)12(6)17-8(3)11(14)7(2)16-17/h4-5H,15H2,1-3H3 |
| InChIKey | AIUCVFZVPSXMIG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|