About 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide
2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide (PubChem CID 79466814) has the molecular formula C11H13ClN4O2S
and a molecular weight of 300.77 g/mol. Its IUPAC name is 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide |
| PubChem CID | 79466814 |
| Molecular Formula | C11H13ClN4O2S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide |
| SMILES | Cc1nn(-c2ccc(S(N)(=O)=O)c(N)c2)c(C)c1Cl |
| InChI | InChI=1S/C11H13ClN4O2S/c1-6-11(12)7(2)16(15-6)8-3-4-10(9(13)5-8)19(14,17)18/h3-5H,13H2,1-2H3,(H2,14,17,18) |
| InChIKey | BMHSBDCGHIEECD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide?
The IUPAC name of 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide (CID 79466814) is 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide.
What is the SMILES notation for 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide?
The canonical SMILES for 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide is Cc1nn(-c2ccc(S(N)(=O)=O)c(N)c2)c(C)c1Cl.
What is the InChIKey of 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide?
The InChIKey is BMHSBDCGHIEECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN4O2S/c1-6-11(12)7(2)16(15-6)8-3-4-10(9(13)5-8)19(14,17)18/h3-5H,13H2,1-2H3,(H2,14,17,18).
What are the key properties of 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide?
2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide has a molecular weight of 300.77 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzenesulfonamide is sourced from PubChem (CID 79466814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).