C13H17N3O2S — CID 61394885
1-(3,5-dimethylphenyl)-3,5-dimethylpyrazole-4-sulfonamide (PubChem CID 61394885) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | 1-(3,5-dimethylphenyl)-3,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61394885 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3,5-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1cc(C)cc(-n2nc(C)c(S(N)(=O)=O)c2C)c1 |
| InChI | InChI=1S/C13H17N3O2S/c1-8-5-9(2)7-12(6-8)16-11(4)13(10(3)15-16)19(14,17)18/h5-7H,1-4H3,(H2,14,17,18) |
| InChIKey | AKGOYCMMQIBSEB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |