C13H14N4O2S — CID 116647252
4-cyano-1-(3,5-dimethylphenyl)-3-methylpyrazole-5-sulfonamide (PubChem CID 116647252) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 4-cyano-1-(3,5-dimethylphenyl)-3-methylpyrazole-5-sulfonamide.
| Compound Name | 4-cyano-1-(3,5-dimethylphenyl)-3-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 116647252 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-cyano-1-(3,5-dimethylphenyl)-3-methylpyrazole-5-sulfonamide |
| SMILES | Cc1cc(C)cc(-n2nc(C)c(C#N)c2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H14N4O2S/c1-8-4-9(2)6-11(5-8)17-13(20(15,18)19)12(7-14)10(3)16-17/h4-6H,1-3H3,(H2,15,18,19) |
| InChIKey | YZEAFKGJXBMFDD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |