C12H10BrN3 — CID 39375121
1-(4-bromophenyl)-3,5-dimethylpyrazole-4-carbonitrile (PubChem CID 39375121) has the molecular formula C12H10BrN3 and a molecular weight of 276.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3,5-dimethylpyrazole-4-carbonitrile.
| Compound Name | 1-(4-bromophenyl)-3,5-dimethylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 39375121 |
| Molecular Formula | C12H10BrN3 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-(4-bromophenyl)-3,5-dimethylpyrazole-4-carbonitrile |
| SMILES | Cc1nn(-c2ccc(Br)cc2)c(C)c1C#N |
| InChI | InChI=1S/C12H10BrN3/c1-8-12(7-14)9(2)16(15-8)11-5-3-10(13)4-6-11/h3-6H,1-2H3 |
| InChIKey | BWDSCRMHUTVIBN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |