C13H12N4O — CID 12522117
N-[4-(4-cyano-3,5-dimethylpyrazol-1-yl)phenyl]formamide (PubChem CID 12522117) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is N-[4-(4-cyano-3,5-dimethylpyrazol-1-yl)phenyl]formamide.
| Compound Name | N-[4-(4-cyano-3,5-dimethylpyrazol-1-yl)phenyl]formamide |
|---|---|
| PubChem CID | 12522117 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N-[4-(4-cyano-3,5-dimethylpyrazol-1-yl)phenyl]formamide |
| SMILES | Cc1nn(-c2ccc(NC=O)cc2)c(C)c1C#N |
| InChI | InChI=1S/C13H12N4O/c1-9-13(7-14)10(2)17(16-9)12-5-3-11(4-6-12)15-8-18/h3-6,8H,1-2H3,(H,15,18) |
| InChIKey | YKHOVRFMBWJGAY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|