C8H7N5O2S2 — CID 116647294
4-cyano-3-methyl-1-(1,3-thiazol-2-yl)pyrazole-5-sulfonamide (PubChem CID 116647294) has the molecular formula C8H7N5O2S2 and a molecular weight of 269.31 g/mol. Its IUPAC name is 4-cyano-3-methyl-1-(1,3-thiazol-2-yl)pyrazole-5-sulfonamide.
| Compound Name | 4-cyano-3-methyl-1-(1,3-thiazol-2-yl)pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 116647294 |
| Molecular Formula | C8H7N5O2S2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 4-cyano-3-methyl-1-(1,3-thiazol-2-yl)pyrazole-5-sulfonamide |
| SMILES | Cc1nn(-c2nccs2)c(S(N)(=O)=O)c1C#N |
| InChI | InChI=1S/C8H7N5O2S2/c1-5-6(4-9)7(17(10,14)15)13(12-5)8-11-2-3-16-8/h2-3H,1H3,(H2,10,14,15) |
| InChIKey | LHCLSAIDZFNFKM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |