C7H7N5O2S — CID 82878905
3-methyl-4-nitro-1-(1,3-thiazol-2-yl)pyrazol-5-amine (PubChem CID 82878905) has the molecular formula C7H7N5O2S and a molecular weight of 225.23 g/mol. Its IUPAC name is 3-methyl-4-nitro-1-(1,3-thiazol-2-yl)pyrazol-5-amine.
| Compound Name | 3-methyl-4-nitro-1-(1,3-thiazol-2-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 82878905 |
| Molecular Formula | C7H7N5O2S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 3-methyl-4-nitro-1-(1,3-thiazol-2-yl)pyrazol-5-amine |
| SMILES | Cc1nn(-c2nccs2)c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N5O2S/c1-4-5(12(13)14)6(8)11(10-4)7-9-2-3-15-7/h2-3H,8H2,1H3 |
| InChIKey | VZOOMLNJKUMMLT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|