C10H12N6O2 — CID 80857004
5-nitro-6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-amine (PubChem CID 80857004) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 5-nitro-6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-amine.
| Compound Name | 5-nitro-6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80857004 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-nitro-6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-amine |
| SMILES | Cc1nn(-c2ncnc(N)c2[N+](=O)[O-])c(C)c1C |
| InChI | InChI=1S/C10H12N6O2/c1-5-6(2)14-15(7(5)3)10-8(16(17)18)9(11)12-4-13-10/h4H,1-3H3,(H2,11,12,13) |
| InChIKey | VULWPILGHCEDPJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|