About 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole
1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole (PubChem CID 62690850) has the molecular formula C12H12FN3O2
and a molecular weight of 249.25 g/mol. Its IUPAC name is 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole.
Molecular Properties
| Compound Name | 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole |
| PubChem CID | 62690850 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole |
| SMILES | Cc1nn(-c2cccc(F)c2[N+](=O)[O-])c(C)c1C |
| InChI | InChI=1S/C12H12FN3O2/c1-7-8(2)14-15(9(7)3)11-6-4-5-10(13)12(11)16(17)18/h4-6H,1-3H3 |
| InChIKey | SAXIFZIWZJTXIS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole?
The IUPAC name of 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole (CID 62690850) is 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole.
What is the SMILES notation for 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole?
The canonical SMILES for 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole is Cc1nn(-c2cccc(F)c2[N+](=O)[O-])c(C)c1C.
What is the InChIKey of 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole?
The InChIKey is SAXIFZIWZJTXIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O2/c1-7-8(2)14-15(9(7)3)11-6-4-5-10(13)12(11)16(17)18/h4-6H,1-3H3.
What are the key properties of 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole?
1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole has a molecular weight of 249.25 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluoro-2-nitrophenyl)-3,4,5-trimethylpyrazole is sourced from PubChem (CID 62690850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).