C13H15N3O3 — CID 61224977
[5-nitro-2-(3,4,5-trimethylpyrazol-1-yl)phenyl]methanol (PubChem CID 61224977) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is [5-nitro-2-(3,4,5-trimethylpyrazol-1-yl)phenyl]methanol.
| Compound Name | [5-nitro-2-(3,4,5-trimethylpyrazol-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 61224977 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | [5-nitro-2-(3,4,5-trimethylpyrazol-1-yl)phenyl]methanol |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2CO)c(C)c1C |
| InChI | InChI=1S/C13H15N3O3/c1-8-9(2)14-15(10(8)3)13-5-4-12(16(18)19)6-11(13)7-17/h4-6,17H,7H2,1-3H3 |
| InChIKey | DOHQSQJUMQBFCI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|