C11H11BrN4O2 — CID 55080397
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-nitroaniline (PubChem CID 55080397) has the molecular formula C11H11BrN4O2 and a molecular weight of 311.14 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-nitroaniline.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-nitroaniline |
|---|---|
| PubChem CID | 55080397 |
| Molecular Formula | C11H11BrN4O2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-nitroaniline |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2N)c(C)c1Br |
| InChI | InChI=1S/C11H11BrN4O2/c1-6-11(12)7(2)15(14-6)10-4-3-8(16(17)18)5-9(10)13/h3-5H,13H2,1-2H3 |
| InChIKey | KSMAKGCZNWAUEC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|