C13H14BrN3O4 — CID 83004087
4-bromo-1-(4,5-dimethoxy-2-nitrophenyl)-3,5-dimethylpyrazole (PubChem CID 83004087) has the molecular formula C13H14BrN3O4 and a molecular weight of 356.18 g/mol. Its IUPAC name is 4-bromo-1-(4,5-dimethoxy-2-nitrophenyl)-3,5-dimethylpyrazole.
| Compound Name | 4-bromo-1-(4,5-dimethoxy-2-nitrophenyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 83004087 |
| Molecular Formula | C13H14BrN3O4 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-bromo-1-(4,5-dimethoxy-2-nitrophenyl)-3,5-dimethylpyrazole |
| SMILES | COc1cc(-n2nc(C)c(Br)c2C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H14BrN3O4/c1-7-13(14)8(2)16(15-7)9-5-11(20-3)12(21-4)6-10(9)17(18)19/h5-6H,1-4H3 |
| InChIKey | PSAVFPVVIAXBKQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|