C12H11N3O6 — CID 83004258
1-(4,5-dimethoxy-2-nitrophenyl)imidazole-4-carboxylic acid (PubChem CID 83004258) has the molecular formula C12H11N3O6 and a molecular weight of 293.24 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)imidazole-4-carboxylic acid.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 83004258 |
| Molecular Formula | C12H11N3O6 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)imidazole-4-carboxylic acid |
| SMILES | COc1cc(-n2cnc(C(=O)O)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H11N3O6/c1-20-10-3-8(9(15(18)19)4-11(10)21-2)14-5-7(12(16)17)13-6-14/h3-6H,1-2H3,(H,16,17) |
| InChIKey | NKELDLZIEIRJMA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|