C12H13N5O5 — CID 174496399
1-(2-amino-4,5-dimethoxyphenyl)-4-nitropyrazole-3-carboxamide (PubChem CID 174496399) has the molecular formula C12H13N5O5 and a molecular weight of 307.27 g/mol. Its IUPAC name is 1-(2-amino-4,5-dimethoxyphenyl)-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-(2-amino-4,5-dimethoxyphenyl)-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 174496399 |
| Molecular Formula | C12H13N5O5 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-(2-amino-4,5-dimethoxyphenyl)-4-nitropyrazole-3-carboxamide |
| SMILES | COc1cc(N)c(-n2cc([N+](=O)[O-])c(C(N)=O)n2)cc1OC |
| InChI | InChI=1S/C12H13N5O5/c1-21-9-3-6(13)7(4-10(9)22-2)16-5-8(17(19)20)11(15-16)12(14)18/h3-5H,13H2,1-2H3,(H2,14,18) |
| InChIKey | CJFWYKBJLUPEOH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 148.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|