C16H16BrNO6 — CID 10408539
1-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxy-2-nitrobenzene (PubChem CID 10408539) has the molecular formula C16H16BrNO6 and a molecular weight of 398.21 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxy-2-nitrobenzene.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxy-2-nitrobenzene |
|---|---|
| PubChem CID | 10408539 |
| Molecular Formula | C16H16BrNO6 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxy-2-nitrobenzene |
| SMILES | COc1cc(Br)c(-c2cc(OC)c(OC)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H16BrNO6/c1-21-13-5-9(11(17)7-15(13)23-3)10-6-14(22-2)16(24-4)8-12(10)18(19)20/h5-8H,1-4H3 |
| InChIKey | CDUXKUSEEDILBI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|