About 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline
2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline (PubChem CID 12695180) has the molecular formula C19H18N2O6
and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline.
Molecular Properties
| Compound Name | 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline |
| PubChem CID | 12695180 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline |
| SMILES | COc1cc(-c2ccc3cc(OC)c(OC)cc3n2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H18N2O6/c1-24-16-7-11-5-6-13(20-14(11)9-18(16)26-3)12-8-17(25-2)19(27-4)10-15(12)21(22)23/h5-10H,1-4H3 |
| InChIKey | UBWGTZCJRNHIME-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline?
The IUPAC name of 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline (CID 12695180) is 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline.
What is the SMILES notation for 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline?
The canonical SMILES for 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline is COc1cc(-c2ccc3cc(OC)c(OC)cc3n2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline?
The InChIKey is UBWGTZCJRNHIME-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O6/c1-24-16-7-11-5-6-13(20-14(11)9-18(16)26-3)12-8-17(25-2)19(27-4)10-15(12)21(22)23/h5-10H,1-4H3.
What are the key properties of 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline?
2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline has a molecular weight of 370.36 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethoxy-2-nitrophenyl)-6,7-dimethoxyquinoline is sourced from PubChem (CID 12695180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).