C10H9N3O6 — CID 51063963
5-(4,5-dimethoxy-2-nitrophenyl)-3H-1,3,4-oxadiazol-2-one (PubChem CID 51063963) has the molecular formula C10H9N3O6 and a molecular weight of 267.20 g/mol. Its IUPAC name is 5-(4,5-dimethoxy-2-nitrophenyl)-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(4,5-dimethoxy-2-nitrophenyl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 51063963 |
| Molecular Formula | C10H9N3O6 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 5-(4,5-dimethoxy-2-nitrophenyl)-3H-1,3,4-oxadiazol-2-one |
| SMILES | COc1cc(-c2n[nH]c(=O)o2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C10H9N3O6/c1-17-7-3-5(9-11-12-10(14)19-9)6(13(15)16)4-8(7)18-2/h3-4H,1-2H3,(H,12,14) |
| InChIKey | ZORQHIPFXRZXSX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|