C16H17Br2NO6 — CID 160559633
4-bromo-1,2-dimethoxybenzene;1-bromo-4,5-dimethoxy-2-nitrobenzene (PubChem CID 160559633) has the molecular formula C16H17Br2NO6 and a molecular weight of 479.12 g/mol. Its IUPAC name is 4-bromo-1,2-dimethoxybenzene;1-bromo-4,5-dimethoxy-2-nitrobenzene.
| Compound Name | 4-bromo-1,2-dimethoxybenzene;1-bromo-4,5-dimethoxy-2-nitrobenzene |
|---|---|
| PubChem CID | 160559633 |
| Molecular Formula | C16H17Br2NO6 |
| Molecular Weight | 479.12 g/mol |
| Exact Mass | 476.94 |
| IUPAC Name | 4-bromo-1,2-dimethoxybenzene;1-bromo-4,5-dimethoxy-2-nitrobenzene |
| SMILES | COc1cc(Br)c([N+](=O)[O-])cc1OC.COc1ccc(Br)cc1OC |
| InChI | InChI=1S/C8H8BrNO4.C8H9BrO2/c1-13-7-3-5(9)6(10(11)12)4-8(7)14-2;1-10-7-4-3-6(9)5-8(7)11-2/h3-4H,1-2H3;3-5H,1-2H3 |
| InChIKey | QZDBZNMCYSPYCZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.12 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|