C14H11BrN4O2 — CID 103964827
4-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-nitroquinoline (PubChem CID 103964827) has the molecular formula C14H11BrN4O2 and a molecular weight of 347.17 g/mol. Its IUPAC name is 4-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-nitroquinoline.
| Compound Name | 4-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-nitroquinoline |
|---|---|
| PubChem CID | 103964827 |
| Molecular Formula | C14H11BrN4O2 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 4-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-nitroquinoline |
| SMILES | Cc1nn(-c2c([N+](=O)[O-])cnc3ccccc23)c(C)c1Br |
| InChI | InChI=1S/C14H11BrN4O2/c1-8-13(15)9(2)18(17-8)14-10-5-3-4-6-11(10)16-7-12(14)19(20)21/h3-7H,1-2H3 |
| InChIKey | BZMRMSLRXVSKJW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|