C13H13N3O4 — CID 106673427
1-(3-nitroquinolin-4-yl)pyrrolidine-3,4-diol (PubChem CID 106673427) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 1-(3-nitroquinolin-4-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(3-nitroquinolin-4-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106673427 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1-(3-nitroquinolin-4-yl)pyrrolidine-3,4-diol |
| SMILES | O=[N+]([O-])c1cnc2ccccc2c1N1CC(O)C(O)C1 |
| InChI | InChI=1S/C13H13N3O4/c17-11-6-15(7-12(11)18)13-8-3-1-2-4-9(8)14-5-10(13)16(19)20/h1-5,11-12,17-18H,6-7H2 |
| InChIKey | VZMUVASUFYKSGI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|