C12H9BrClN3O4 — CID 107186596
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-chloro-5-nitrobenzoic acid (PubChem CID 107186596) has the molecular formula C12H9BrClN3O4 and a molecular weight of 374.58 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-chloro-5-nitrobenzoic acid.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-chloro-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 107186596 |
| Molecular Formula | C12H9BrClN3O4 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-chloro-5-nitrobenzoic acid |
| SMILES | Cc1nn(-c2c(Cl)cc([N+](=O)[O-])cc2C(=O)O)c(C)c1Br |
| InChI | InChI=1S/C12H9BrClN3O4/c1-5-10(13)6(2)16(15-5)11-8(12(18)19)3-7(17(20)21)4-9(11)14/h3-4H,1-2H3,(H,18,19) |
| InChIKey | WDHOEZGTHLGZSY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|