C11H8ClN3O6 — CID 107190895
3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid (PubChem CID 107190895) has the molecular formula C11H8ClN3O6 and a molecular weight of 313.65 g/mol. Its IUPAC name is 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid.
| Compound Name | 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 107190895 |
| Molecular Formula | C11H8ClN3O6 |
| Molecular Weight | 313.65 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid |
| SMILES | O=C1CN(c2c(Cl)cc([N+](=O)[O-])cc2C(=O)O)CC(=O)N1 |
| InChI | InChI=1S/C11H8ClN3O6/c12-7-2-5(15(20)21)1-6(11(18)19)10(7)14-3-8(16)13-9(17)4-14/h1-2H,3-4H2,(H,18,19)(H,13,16,17) |
| InChIKey | YQKOBMGKMAKCML-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.65 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|