3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid

C11H8ClN3O6 — CID 107190895

IUPAC3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid
SMILESO=C1CN(c2c(Cl)cc([N+](=O)[O-])cc2C(=O)O)CC(=O)N1
InChIInChI=1S/C11H8ClN3O6/c12-7-2-5(15(20)21)1-6(11(18)19)10(7)14-3-8(16)13-9(17)4-14/h1-2H,3-4H2,(H,18,19)(H,13,16,17)
InChIKeyYQKOBMGKMAKCML-UHFFFAOYSA-N
MW313.65 g/mol
LogP0.41
Rot. Bonds3

About 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid

3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid (PubChem CID 107190895) has the molecular formula C11H8ClN3O6 and a molecular weight of 313.65 g/mol. Its IUPAC name is 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid.

Molecular Properties

Compound Name3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid
PubChem CID107190895
Molecular FormulaC11H8ClN3O6
Molecular Weight313.65 g/mol
Exact Mass313.01
IUPAC Name3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid
SMILESO=C1CN(c2c(Cl)cc([N+](=O)[O-])cc2C(=O)O)CC(=O)N1
InChIInChI=1S/C11H8ClN3O6/c12-7-2-5(15(20)21)1-6(11(18)19)10(7)14-3-8(16)13-9(17)4-14/h1-2H,3-4H2,(H,18,19)(H,13,16,17)
InChIKeyYQKOBMGKMAKCML-UHFFFAOYSA-N
XLogP0.41
TPSA129.85 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.65
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid?
The IUPAC name of 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid (CID 107190895) is 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid.
What is the SMILES notation for 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid?
The canonical SMILES for 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid is O=C1CN(c2c(Cl)cc([N+](=O)[O-])cc2C(=O)O)CC(=O)N1.
What is the InChIKey of 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid?
The InChIKey is YQKOBMGKMAKCML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3O6/c12-7-2-5(15(20)21)1-6(11(18)19)10(7)14-3-8(16)13-9(17)4-14/h1-2H,3-4H2,(H,18,19)(H,13,16,17).
What are the key properties of 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid?
3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid has a molecular weight of 313.65 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-(3,5-dioxopiperazin-1-yl)-5-nitrobenzoic acid is sourced from PubChem (CID 107190895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).