1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid

C11H11Cl2N3O4 — CID 106891819

IUPAC1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid
SMILESO=C(O)C1CNCCN1c1c(Cl)cc([N+](=O)[O-])cc1Cl
InChIInChI=1S/C11H11Cl2N3O4/c12-7-3-6(16(19)20)4-8(13)10(7)15-2-1-14-5-9(15)11(17)18/h3-4,9,14H,1-2,5H2,(H,17,18)
InChIKeyMIJIBPAUZSUFTL-UHFFFAOYSA-N
MW320.13 g/mol
LogP1.76
Rot. Bonds3

About 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid

1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid (PubChem CID 106891819) has the molecular formula C11H11Cl2N3O4 and a molecular weight of 320.13 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid.

Molecular Properties

Compound Name1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid
PubChem CID106891819
Molecular FormulaC11H11Cl2N3O4
Molecular Weight320.13 g/mol
Exact Mass319.01
IUPAC Name1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid
SMILESO=C(O)C1CNCCN1c1c(Cl)cc([N+](=O)[O-])cc1Cl
InChIInChI=1S/C11H11Cl2N3O4/c12-7-3-6(16(19)20)4-8(13)10(7)15-2-1-14-5-9(15)11(17)18/h3-4,9,14H,1-2,5H2,(H,17,18)
InChIKeyMIJIBPAUZSUFTL-UHFFFAOYSA-N
XLogP1.76
TPSA95.71 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.13
LogP ≤ 51.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid?
The IUPAC name of 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid (CID 106891819) is 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid.
What is the SMILES notation for 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid?
The canonical SMILES for 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid is O=C(O)C1CNCCN1c1c(Cl)cc([N+](=O)[O-])cc1Cl.
What is the InChIKey of 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid?
The InChIKey is MIJIBPAUZSUFTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2N3O4/c12-7-3-6(16(19)20)4-8(13)10(7)15-2-1-14-5-9(15)11(17)18/h3-4,9,14H,1-2,5H2,(H,17,18).
What are the key properties of 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid?
1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid has a molecular weight of 320.13 g/mol, XLogP of 1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dichloro-4-nitrophenyl)piperazine-2-carboxylic acid is sourced from PubChem (CID 106891819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).