C10H10Cl2N2O3 — CID 103952620
(3R)-1-(2,6-dichloro-4-nitrophenyl)pyrrolidin-3-ol (PubChem CID 103952620) has the molecular formula C10H10Cl2N2O3 and a molecular weight of 277.11 g/mol. Its IUPAC name is (3R)-1-(2,6-dichloro-4-nitrophenyl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(2,6-dichloro-4-nitrophenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 103952620 |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | (3R)-1-(2,6-dichloro-4-nitrophenyl)pyrrolidin-3-ol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(N2CC[C@@H](O)C2)c(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2N2O3/c11-8-3-6(14(16)17)4-9(12)10(8)13-2-1-7(15)5-13/h3-4,7,15H,1-2,5H2/t7-/m1/s1 |
| InChIKey | GOCJATCBUNHROU-SSDOTTSWSA-N |
| XLogP | 2.47 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|