C15H16Cl2N4O2 — CID 133491389
1-(2,6-dichloro-4-nitrophenyl)-3-imidazol-1-yl-4-methylpiperidine (PubChem CID 133491389) has the molecular formula C15H16Cl2N4O2 and a molecular weight of 355.23 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)-3-imidazol-1-yl-4-methylpiperidine.
| Compound Name | 1-(2,6-dichloro-4-nitrophenyl)-3-imidazol-1-yl-4-methylpiperidine |
|---|---|
| PubChem CID | 133491389 |
| Molecular Formula | C15H16Cl2N4O2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenyl)-3-imidazol-1-yl-4-methylpiperidine |
| SMILES | CC1CCN(c2c(Cl)cc([N+](=O)[O-])cc2Cl)CC1n1ccnc1 |
| InChI | InChI=1S/C15H16Cl2N4O2/c1-10-2-4-19(8-14(10)20-5-3-18-9-20)15-12(16)6-11(21(22)23)7-13(15)17/h3,5-7,9-10,14H,2,4,8H2,1H3 |
| InChIKey | KXJMYESMEAKQQO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|