C14H15Cl2N5O2 — CID 133454657
1-(2,6-dichloro-4-nitrophenyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine (PubChem CID 133454657) has the molecular formula C14H15Cl2N5O2 and a molecular weight of 356.21 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine.
| Compound Name | 1-(2,6-dichloro-4-nitrophenyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine |
|---|---|
| PubChem CID | 133454657 |
| Molecular Formula | C14H15Cl2N5O2 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine |
| SMILES | O=[N+]([O-])c1cc(Cl)c(N2CCCC(Cn3cncn3)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2N5O2/c15-12-4-11(21(22)23)5-13(16)14(12)19-3-1-2-10(6-19)7-20-9-17-8-18-20/h4-5,8-10H,1-3,6-7H2 |
| InChIKey | WLLJIOBWCFJGBI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|