About N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide
N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide (PubChem CID 133339116) has the molecular formula C14H19N7O
and a molecular weight of 301.35 g/mol. Its IUPAC name is N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide |
| PubChem CID | 133339116 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCCC(Cn3cncn3)C2)nn1 |
| InChI | InChI=1S/C14H19N7O/c1-15-14(22)12-4-5-13(19-18-12)20-6-2-3-11(7-20)8-21-10-16-9-17-21/h4-5,9-11H,2-3,6-8H2,1H3,(H,15,22) |
| InChIKey | XHCOXMITEYMWEK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide?
The IUPAC name of N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide (CID 133339116) is N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide.
What is the SMILES notation for N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide?
The canonical SMILES for N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide is CNC(=O)c1ccc(N2CCCC(Cn3cncn3)C2)nn1.
What is the InChIKey of N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide?
The InChIKey is XHCOXMITEYMWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N7O/c1-15-14(22)12-4-5-13(19-18-12)20-6-2-3-11(7-20)8-21-10-16-9-17-21/h4-5,9-11H,2-3,6-8H2,1H3,(H,15,22).
What are the key properties of N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide?
N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide has a molecular weight of 301.35 g/mol, XLogP of 0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]pyridazine-3-carboxamide is sourced from PubChem (CID 133339116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).