C14H18N4O — CID 96566216
6-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-N-methylpyridazine-3-carboxamide (PubChem CID 96566216) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 6-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-N-methylpyridazine-3-carboxamide.
| Compound Name | 6-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-N-methylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 96566216 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 6-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-N-methylpyridazine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(N2C[C@H]3CC=CC[C@H]3C2)nn1 |
| InChI | InChI=1S/C14H18N4O/c1-15-14(19)12-6-7-13(17-16-12)18-8-10-4-2-3-5-11(10)9-18/h2-3,6-7,10-11H,4-5,8-9H2,1H3,(H,15,19)/t10-,11+ |
| InChIKey | ABYKTJUYCIPQAI-PHIMTYICSA-N |
| XLogP | 1.24 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|