C13H16N4O — CID 95971166
6-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyridazine-3-carboxamide (PubChem CID 95971166) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 6-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyridazine-3-carboxamide.
| Compound Name | 6-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 95971166 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 6-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyridazine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2C[C@H]3CC=CC[C@H]3C2)nn1 |
| InChI | InChI=1S/C13H16N4O/c14-13(18)11-5-6-12(16-15-11)17-7-9-3-1-2-4-10(9)8-17/h1-2,5-6,9-10H,3-4,7-8H2,(H2,14,18)/t9-,10+ |
| InChIKey | LPXTWNCWSPKBJK-AOOOYVTPSA-N |
| XLogP | 0.98 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|