About 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide
6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide (PubChem CID 133339812) has the molecular formula C12H12F6N4O
and a molecular weight of 342.24 g/mol. Its IUPAC name is 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide |
| PubChem CID | 133339812 |
| Molecular Formula | C12H12F6N4O |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCC(C(F)(F)F)(C(F)(F)F)C2)nn1 |
| InChI | InChI=1S/C12H12F6N4O/c1-19-9(23)7-2-3-8(21-20-7)22-5-4-10(6-22,11(13,14)15)12(16,17)18/h2-3H,4-6H2,1H3,(H,19,23) |
| InChIKey | WPZWRTYHALZMJB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide?
The IUPAC name of 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide (CID 133339812) is 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide.
What is the SMILES notation for 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide?
The canonical SMILES for 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide is CNC(=O)c1ccc(N2CCC(C(F)(F)F)(C(F)(F)F)C2)nn1.
What is the InChIKey of 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide?
The InChIKey is WPZWRTYHALZMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F6N4O/c1-19-9(23)7-2-3-8(21-20-7)22-5-4-10(6-22,11(13,14)15)12(16,17)18/h2-3H,4-6H2,1H3,(H,19,23).
What are the key properties of 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide?
6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide has a molecular weight of 342.24 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-N-methylpyridazine-3-carboxamide is sourced from PubChem (CID 133339812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).