C13H17F4N5O — CID 133339559
N-methyl-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyridazine-3-carboxamide (PubChem CID 133339559) has the molecular formula C13H17F4N5O and a molecular weight of 335.31 g/mol. Its IUPAC name is N-methyl-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-methyl-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133339559 |
| Molecular Formula | C13H17F4N5O |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-methyl-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyridazine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(CC(F)(F)C(F)F)CC2)nn1 |
| InChI | InChI=1S/C13H17F4N5O/c1-18-11(23)9-2-3-10(20-19-9)22-6-4-21(5-7-22)8-13(16,17)12(14)15/h2-3,12H,4-8H2,1H3,(H,18,23) |
| InChIKey | UNHARSXOOZCOQE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|