C16H24N4O3 — CID 133322299
methyl 6-[3-(morpholin-4-ylmethyl)piperidin-1-yl]pyridazine-3-carboxylate (PubChem CID 133322299) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 6-[3-(morpholin-4-ylmethyl)piperidin-1-yl]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[3-(morpholin-4-ylmethyl)piperidin-1-yl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 133322299 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | methyl 6-[3-(morpholin-4-ylmethyl)piperidin-1-yl]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCCC(CN3CCOCC3)C2)nn1 |
| InChI | InChI=1S/C16H24N4O3/c1-22-16(21)14-4-5-15(18-17-14)20-6-2-3-13(12-20)11-19-7-9-23-10-8-19/h4-5,13H,2-3,6-12H2,1H3 |
| InChIKey | BSPHQKACYUYWKJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |