C21H28N6O2 — CID 133279613
methyl 6-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyridazine-3-carboxylate (PubChem CID 133279613) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is methyl 6-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 133279613 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | methyl 6-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCCC(CN3CCN(c4ccccn4)CC3)C2)nn1 |
| InChI | InChI=1S/C21H28N6O2/c1-29-21(28)18-7-8-20(24-23-18)27-10-4-5-17(16-27)15-25-11-13-26(14-12-25)19-6-2-3-9-22-19/h2-3,6-9,17H,4-5,10-16H2,1H3 |
| InChIKey | CEMCQJORKDJCDC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |