C18H28N4O2 — CID 124721465
methyl 2-[(3S)-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]acetate (PubChem CID 124721465) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is methyl 2-[(3S)-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]acetate.
| Compound Name | methyl 2-[(3S)-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 124721465 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | methyl 2-[(3S)-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]acetate |
| SMILES | COC(=O)CN1CCC[C@@H](CN2CCN(c3ccccn3)CC2)C1 |
| InChI | InChI=1S/C18H28N4O2/c1-24-18(23)15-21-8-4-5-16(14-21)13-20-9-11-22(12-10-20)17-6-2-3-7-19-17/h2-3,6-7,16H,4-5,8-15H2,1H3/t16-/m0/s1 |
| InChIKey | ADIMISWXGDECMM-INIZCTEOSA-N |
| XLogP | 1.09 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |