C18H29N5O — CID 119902888
3-amino-1-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]propan-1-one (PubChem CID 119902888) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-amino-1-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-amino-1-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 119902888 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 3-amino-1-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]propan-1-one |
| SMILES | NCCC(=O)N1CCCC(CN2CCN(c3ccccn3)CC2)C1 |
| InChI | InChI=1S/C18H29N5O/c19-7-6-18(24)23-9-3-4-16(15-23)14-21-10-12-22(13-11-21)17-5-1-2-8-20-17/h1-2,5,8,16H,3-4,6-7,9-15,19H2 |
| InChIKey | IDGWOLXDNQYCHM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |