C20H34N4O — CID 110923901
5-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pentan-1-ol (PubChem CID 110923901) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is 5-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pentan-1-ol.
| Compound Name | 5-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 110923901 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 5-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pentan-1-ol |
| SMILES | OCCCCCN1CCCC(CN2CCN(c3ccccn3)CC2)C1 |
| InChI | InChI=1S/C20H34N4O/c25-16-5-1-4-10-22-11-6-7-19(17-22)18-23-12-14-24(15-13-23)20-8-2-3-9-21-20/h2-3,8-9,19,25H,1,4-7,10-18H2 |
| InChIKey | AIRGPXSOGFTVHH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|