C19H25ClN6 — CID 133279639
2-chloro-6-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyrazine (PubChem CID 133279639) has the molecular formula C19H25ClN6 and a molecular weight of 372.90 g/mol. Its IUPAC name is 2-chloro-6-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyrazine.
| Compound Name | 2-chloro-6-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyrazine |
|---|---|
| PubChem CID | 133279639 |
| Molecular Formula | C19H25ClN6 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-chloro-6-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyrazine |
| SMILES | Clc1cncc(N2CCCC(CN3CCN(c4ccccn4)CC3)C2)n1 |
| InChI | InChI=1S/C19H25ClN6/c20-17-12-21-13-19(23-17)26-7-3-4-16(15-26)14-24-8-10-25(11-9-24)18-5-1-2-6-22-18/h1-2,5-6,12-13,16H,3-4,7-11,14-15H2 |
| InChIKey | UWMJUFWJHMWROL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |