C22H30N6 — CID 133300278
2-cyclopropyl-4-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyrimidine (PubChem CID 133300278) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-cyclopropyl-4-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyrimidine.
| Compound Name | 2-cyclopropyl-4-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133300278 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 2-cyclopropyl-4-[3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]pyrimidine |
| SMILES | c1ccc(N2CCN(CC3CCCN(c4ccnc(C5CC5)n4)C3)CC2)nc1 |
| InChI | InChI=1S/C22H30N6/c1-2-9-23-20(5-1)27-14-12-26(13-15-27)16-18-4-3-11-28(17-18)21-8-10-24-22(25-21)19-6-7-19/h1-2,5,8-10,18-19H,3-4,6-7,11-17H2 |
| InChIKey | WAOOIWSLUGDELE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |